C28H34N2O8 — CID 157286955
(E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-en-2-one (PubChem CID 157286955) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is (E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-en-2-one.
| Compound Name | (E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-en-2-one |
|---|---|
| PubChem CID | 157286955 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (E)-4-[4-[[2-hydroxyethyl(1H-indol-3-ylmethyl)amino]methyl]phenyl]-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(CN(CCO)Cc2c[nH]c3ccccc23)cc1)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H34N2O8/c31-12-11-30(15-20-13-29-23-4-2-1-3-22(20)23)14-19-7-5-18(6-8-19)9-10-21(33)17-37-28-27(36)26(35)25(34)24(16-32)38-28/h1-10,13,24-29,31-32,34-36H,11-12,14-17H2/b10-9+/t24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | HOPWYEURFFBCDI-VVTBNOHQSA-N |
| XLogP | 0.56 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|