C20H29NO2 — CID 157287182
1-[3-(9-methoxy-3-propyl-3-azabicyclo[3.3.1]nonan-9-yl)phenyl]ethanone (PubChem CID 157287182) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[3-(9-methoxy-3-propyl-3-azabicyclo[3.3.1]nonan-9-yl)phenyl]ethanone.
| Compound Name | 1-[3-(9-methoxy-3-propyl-3-azabicyclo[3.3.1]nonan-9-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 157287182 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-[3-(9-methoxy-3-propyl-3-azabicyclo[3.3.1]nonan-9-yl)phenyl]ethanone |
| SMILES | CCCN1CC2CCCC(C1)C2(OC)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C20H29NO2/c1-4-11-21-13-18-9-6-10-19(14-21)20(18,23-3)17-8-5-7-16(12-17)15(2)22/h5,7-8,12,18-19H,4,6,9-11,13-14H2,1-3H3 |
| InChIKey | RDJXEGQRLYOZII-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |