C23H31ClN2O4 — CID 163774785
3-[3-[2-(2,5-dioxocyclopentyl)ethyl]-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride (PubChem CID 163774785) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is 3-[3-[2-(2,5-dioxocyclopentyl)ethyl]-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride.
| Compound Name | 3-[3-[2-(2,5-dioxocyclopentyl)ethyl]-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 163774785 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-[3-[2-(2,5-dioxocyclopentyl)ethyl]-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide;hydrochloride |
| SMILES | COC1(c2cccc(C(N)=O)c2)C2CCCC1CN(CCC1C(=O)CCC1=O)C2.Cl |
| InChI | InChI=1S/C23H30N2O4.ClH/c1-29-23(16-5-2-4-15(12-16)22(24)28)17-6-3-7-18(23)14-25(13-17)11-10-19-20(26)8-9-21(19)27;/h2,4-5,12,17-19H,3,6-11,13-14H2,1H3,(H2,24,28);1H |
| InChIKey | LXJSHOYRVBBUDL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|