C16H24N2O2 — CID 157288625
(2S)-5,5-dimethyl-1-[(3-methyl-2H-indazol-4-yl)oxy]hexan-2-ol (PubChem CID 157288625) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2S)-5,5-dimethyl-1-[(3-methyl-2H-indazol-4-yl)oxy]hexan-2-ol.
| Compound Name | (2S)-5,5-dimethyl-1-[(3-methyl-2H-indazol-4-yl)oxy]hexan-2-ol |
|---|---|
| PubChem CID | 157288625 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2S)-5,5-dimethyl-1-[(3-methyl-2H-indazol-4-yl)oxy]hexan-2-ol |
| SMILES | Cc1[nH]nc2cccc(OC[C@@H](O)CCC(C)(C)C)c12 |
| InChI | InChI=1S/C16H24N2O2/c1-11-15-13(18-17-11)6-5-7-14(15)20-10-12(19)8-9-16(2,3)4/h5-7,12,19H,8-10H2,1-4H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | YHNIDGVFUJSHHR-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |