C25H31N3O2 — CID 157293221
ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate (PubChem CID 157293221) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate.
| Compound Name | ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 157293221 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(CC23CC4CC(CC(C4)C2)C3)c(NCc2ccncn2)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-2-30-24(29)20-3-4-21(23(10-20)27-15-22-5-6-26-16-28-22)14-25-11-17-7-18(12-25)9-19(8-17)13-25/h3-6,10,16-19,27H,2,7-9,11-15H2,1H3 |
| InChIKey | NZQSYNVUFAJIAD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |