About 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane
3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane (PubChem CID 157296879) has the molecular formula C15H18N4S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane.
Molecular Properties
| Compound Name | 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane |
| PubChem CID | 157296879 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane |
| SMILES | Cc1[nH]nc2ccnc(N[C@@H](C)c3ccccc3)c12.S |
| InChI | InChI=1S/C15H16N4.H2S/c1-10(12-6-4-3-5-7-12)17-15-14-11(2)18-19-13(14)8-9-16-15;/h3-10H,1-2H3,(H,16,17)(H,18,19);1H2/t10-;/m0./s1 |
| InChIKey | BBLHHEUCWLNHIJ-PPHPATTJSA-N |
| XLogP | 3.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane?
The IUPAC name of 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane (CID 157296879) is 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane.
What is the SMILES notation for 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane?
The canonical SMILES for 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane is Cc1[nH]nc2ccnc(N[C@@H](C)c3ccccc3)c12.S.
What is the InChIKey of 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane?
The InChIKey is BBLHHEUCWLNHIJ-PPHPATTJSA-N. The full InChI is InChI=1S/C15H16N4.H2S/c1-10(12-6-4-3-5-7-12)17-15-14-11(2)18-19-13(14)8-9-16-15;/h3-10H,1-2H3,(H,16,17)(H,18,19);1H2/t10-;/m0./s1.
What are the key properties of 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane?
3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane has a molecular weight of 286.40 g/mol, XLogP of 3.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[(1S)-1-phenylethyl]-2H-pyrazolo[4,3-c]pyridin-4-amine;sulfane is sourced from PubChem (CID 157296879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).