C16H14ClN3 — CID 87057014
5-chloro-N-[(1R)-1-phenylethyl]quinazolin-4-amine (PubChem CID 87057014) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-phenylethyl]quinazolin-4-amine.
| Compound Name | 5-chloro-N-[(1R)-1-phenylethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87057014 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-chloro-N-[(1R)-1-phenylethyl]quinazolin-4-amine |
| SMILES | C[C@@H](Nc1ncnc2cccc(Cl)c12)c1ccccc1 |
| InChI | InChI=1S/C16H14ClN3/c1-11(12-6-3-2-4-7-12)20-16-15-13(17)8-5-9-14(15)18-10-19-16/h2-11H,1H3,(H,18,19,20)/t11-/m1/s1 |
| InChIKey | KKNMASPTQAIFCW-LLVKDONJSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |