C22H18Cl2N4 — CID 56729213
2-N-(2,3-dichlorophenyl)-4-N-(1-phenylethyl)quinazoline-2,4-diamine (PubChem CID 56729213) has the molecular formula C22H18Cl2N4 and a molecular weight of 409.32 g/mol. Its IUPAC name is 2-N-(2,3-dichlorophenyl)-4-N-(1-phenylethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-(2,3-dichlorophenyl)-4-N-(1-phenylethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 56729213 |
| Molecular Formula | C22H18Cl2N4 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-N-(2,3-dichlorophenyl)-4-N-(1-phenylethyl)quinazoline-2,4-diamine |
| SMILES | CC(Nc1nc(Nc2cccc(Cl)c2Cl)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N4/c1-14(15-8-3-2-4-9-15)25-21-16-10-5-6-12-18(16)26-22(28-21)27-19-13-7-11-17(23)20(19)24/h2-14H,1H3,(H2,25,26,27,28) |
| InChIKey | HMPNJHYQYZZIPG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |