dimethyl hydrogen phosphite;formaldehyde;phenol

C9H15O5P — CID 157296965

IUPACdimethyl hydrogen phosphite;formaldehyde;phenol
SMILESC=O.COP(O)OC.Oc1ccccc1
InChIInChI=1S/C6H6O.C2H7O3P.CH2O/c7-6-4-2-1-3-5-6;1-4-6(3)5-2;1-2/h1-5,7H;3H,1-2H3;1H2
InChIKeyBBLNLGQGGQKIBQ-UHFFFAOYSA-N
MW234.19 g/mol
LogP1.71
Rot. Bonds2

About dimethyl hydrogen phosphite;formaldehyde;phenol

dimethyl hydrogen phosphite;formaldehyde;phenol (PubChem CID 157296965) has the molecular formula C9H15O5P and a molecular weight of 234.19 g/mol. Its IUPAC name is dimethyl hydrogen phosphite;formaldehyde;phenol.

Molecular Properties

Compound Namedimethyl hydrogen phosphite;formaldehyde;phenol
PubChem CID157296965
Molecular FormulaC9H15O5P
Molecular Weight234.19 g/mol
Exact Mass234.07
IUPAC Namedimethyl hydrogen phosphite;formaldehyde;phenol
SMILESC=O.COP(O)OC.Oc1ccccc1
InChIInChI=1S/C6H6O.C2H7O3P.CH2O/c7-6-4-2-1-3-5-6;1-4-6(3)5-2;1-2/h1-5,7H;3H,1-2H3;1H2
InChIKeyBBLNLGQGGQKIBQ-UHFFFAOYSA-N
XLogP1.71
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.19
LogP ≤ 51.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dimethyl hydrogen phosphite;formaldehyde;phenol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl hydrogen phosphite;formaldehyde;phenol?
The IUPAC name of dimethyl hydrogen phosphite;formaldehyde;phenol (CID 157296965) is dimethyl hydrogen phosphite;formaldehyde;phenol.
What is the SMILES notation for dimethyl hydrogen phosphite;formaldehyde;phenol?
The canonical SMILES for dimethyl hydrogen phosphite;formaldehyde;phenol is C=O.COP(O)OC.Oc1ccccc1.
What is the InChIKey of dimethyl hydrogen phosphite;formaldehyde;phenol?
The InChIKey is BBLNLGQGGQKIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C2H7O3P.CH2O/c7-6-4-2-1-3-5-6;1-4-6(3)5-2;1-2/h1-5,7H;3H,1-2H3;1H2.
What are the key properties of dimethyl hydrogen phosphite;formaldehyde;phenol?
dimethyl hydrogen phosphite;formaldehyde;phenol has a molecular weight of 234.19 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl hydrogen phosphite;formaldehyde;phenol is sourced from PubChem (CID 157296965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).