C27H32N4O4 — CID 157297178
tert-butyl 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]-6-methylindazol-5-yl]acetate (PubChem CID 157297178) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]-6-methylindazol-5-yl]acetate.
| Compound Name | tert-butyl 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]-6-methylindazol-5-yl]acetate |
|---|---|
| PubChem CID | 157297178 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tert-butyl 2-[2-[2-(4-benzoylpiperazin-1-yl)-2-oxoethyl]-6-methylindazol-5-yl]acetate |
| SMILES | Cc1cc2nn(CC(=O)N3CCN(C(=O)c4ccccc4)CC3)cc2cc1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H32N4O4/c1-19-14-23-22(15-21(19)16-25(33)35-27(2,3)4)17-31(28-23)18-24(32)29-10-12-30(13-11-29)26(34)20-8-6-5-7-9-20/h5-9,14-15,17H,10-13,16,18H2,1-4H3 |
| InChIKey | BBMBMPVUUMAQJN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |