C21H28N4O4 — CID 157401907
tert-butyl 2-[2-[2-(4-ethyl-3-oxopiperazin-1-yl)-2-oxoethyl]indazol-5-yl]acetate (PubChem CID 157401907) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(4-ethyl-3-oxopiperazin-1-yl)-2-oxoethyl]indazol-5-yl]acetate.
| Compound Name | tert-butyl 2-[2-[2-(4-ethyl-3-oxopiperazin-1-yl)-2-oxoethyl]indazol-5-yl]acetate |
|---|---|
| PubChem CID | 157401907 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tert-butyl 2-[2-[2-(4-ethyl-3-oxopiperazin-1-yl)-2-oxoethyl]indazol-5-yl]acetate |
| SMILES | CCN1CCN(C(=O)Cn2cc3cc(CC(=O)OC(C)(C)C)ccc3n2)CC1=O |
| InChI | InChI=1S/C21H28N4O4/c1-5-23-8-9-24(13-18(23)26)19(27)14-25-12-16-10-15(6-7-17(16)22-25)11-20(28)29-21(2,3)4/h6-7,10,12H,5,8-9,11,13-14H2,1-4H3 |
| InChIKey | BNGQDXWWIWZFJC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |