C33H39ClN4O3S — CID 157297622
[(4E)-cyclooct-4-en-1-yl] 8-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-7-oxooctanoate (PubChem CID 157297622) has the molecular formula C33H39ClN4O3S and a molecular weight of 607.22 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] 8-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-7-oxooctanoate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] 8-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-7-oxooctanoate |
|---|---|
| PubChem CID | 157297622 |
| Molecular Formula | C33H39ClN4O3S |
| Molecular Weight | 607.22 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] 8-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-7-oxooctanoate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)CCCCCC(=O)OC1CC/C=C\CCC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C33H39ClN4O3S/c1-21-22(2)42-33-30(21)31(24-16-18-25(34)19-17-24)35-28(32-37-36-23(3)38(32)33)20-26(39)12-8-7-11-15-29(40)41-27-13-9-5-4-6-10-14-27/h4-5,16-19,27-28H,6-15,20H2,1-3H3/b5-4-/t27?,28-/m0/s1 |
| InChIKey | BBNFOHAEMOFGOP-JCCLHQFVSA-N |
| XLogP | 8.14 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.22 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|