C35H26ClF3N8O3 — CID 157297933
N-[4-chloro-3-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;2-nitro-5-pyrrol-1-ylaniline (PubChem CID 157297933) has the molecular formula C35H26ClF3N8O3 and a molecular weight of 699.09 g/mol. Its IUPAC name is N-[4-chloro-3-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;2-nitro-5-pyrrol-1-ylaniline.
| Compound Name | N-[4-chloro-3-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;2-nitro-5-pyrrol-1-ylaniline |
|---|---|
| PubChem CID | 157297933 |
| Molecular Formula | C35H26ClF3N8O3 |
| Molecular Weight | 699.09 g/mol |
| Exact Mass | 698.18 |
| IUPAC Name | N-[4-chloro-3-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)phenyl]-2-methyl-6-(trifluoromethyl)pyridine-3-carboxamide;2-nitro-5-pyrrol-1-ylaniline |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)Nc1ccc(Cl)c(-c2nc3ccc(-n4cccc4)cc3[nH]2)c1.Nc1cc(-n2cccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H17ClF3N5O.C10H9N3O2/c1-14-17(6-9-22(30-14)25(27,28)29)24(35)31-15-4-7-19(26)18(12-15)23-32-20-8-5-16(13-21(20)33-23)34-10-2-3-11-34;11-9-7-8(12-5-1-2-6-12)3-4-10(9)13(14)15/h2-13H,1H3,(H,31,35)(H,32,33);1-7H,11H2 |
| InChIKey | BBODJXYTNUKOFX-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 149.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.09 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|