C10H14O3S — CID 15729828
5-(thian-3-yl)oxane-2,4-dione (PubChem CID 15729828) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-(thian-3-yl)oxane-2,4-dione.
| Compound Name | 5-(thian-3-yl)oxane-2,4-dione |
|---|---|
| PubChem CID | 15729828 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-(thian-3-yl)oxane-2,4-dione |
| SMILES | O=C1CC(=O)C(C2CCCSC2)CO1 |
| InChI | InChI=1S/C10H14O3S/c11-9-4-10(12)13-5-8(9)7-2-1-3-14-6-7/h7-8H,1-6H2 |
| InChIKey | UOWAPTRGBPZHPK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|