C9H12O3S — CID 19912167
1-oxa-9-thiaspiro[5.5]undecane-2,4-dione (PubChem CID 19912167) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-oxa-9-thiaspiro[5.5]undecane-2,4-dione.
| Compound Name | 1-oxa-9-thiaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 19912167 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-oxa-9-thiaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC(=O)OC2(CCSCC2)C1 |
| InChI | InChI=1S/C9H12O3S/c10-7-5-8(11)12-9(6-7)1-3-13-4-2-9/h1-6H2 |
| InChIKey | IDCLRTGUNDNKMT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|