About 6-oxa-2-thiaspiro[4.5]decane-7,9-dione
6-oxa-2-thiaspiro[4.5]decane-7,9-dione (PubChem CID 19912112) has the molecular formula C8H10O3S
and a molecular weight of 186.23 g/mol. Its IUPAC name is 6-oxa-2-thiaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 6-oxa-2-thiaspiro[4.5]decane-7,9-dione |
| PubChem CID | 19912112 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 6-oxa-2-thiaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC(=O)OC2(CCSC2)C1 |
| InChI | InChI=1S/C8H10O3S/c9-6-3-7(10)11-8(4-6)1-2-12-5-8/h1-5H2 |
| InChIKey | IGDRRVYXJUIKDE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-oxa-2-thiaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxa-2-thiaspiro[4.5]decane-7,9-dione?
The IUPAC name of 6-oxa-2-thiaspiro[4.5]decane-7,9-dione (CID 19912112) is 6-oxa-2-thiaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 6-oxa-2-thiaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 6-oxa-2-thiaspiro[4.5]decane-7,9-dione is O=C1CC(=O)OC2(CCSC2)C1.
What is the InChIKey of 6-oxa-2-thiaspiro[4.5]decane-7,9-dione?
The InChIKey is IGDRRVYXJUIKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S/c9-6-3-7(10)11-8(4-6)1-2-12-5-8/h1-5H2.
What are the key properties of 6-oxa-2-thiaspiro[4.5]decane-7,9-dione?
6-oxa-2-thiaspiro[4.5]decane-7,9-dione has a molecular weight of 186.23 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxa-2-thiaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 19912112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).