C21H20N4O2 — CID 157299235
2-[2-ethoxy-4-(3-ethylphenyl)phenyl]-1,7-dihydropurin-6-one (PubChem CID 157299235) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(3-ethylphenyl)phenyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-[2-ethoxy-4-(3-ethylphenyl)phenyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 157299235 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[2-ethoxy-4-(3-ethylphenyl)phenyl]-1,7-dihydropurin-6-one |
| SMILES | CCOc1cc(-c2cccc(CC)c2)ccc1-c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H20N4O2/c1-3-13-6-5-7-14(10-13)15-8-9-16(17(11-15)27-4-2)19-24-20-18(21(26)25-19)22-12-23-20/h5-12H,3-4H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | XEPMTRIUQSBDQY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |