C21H18N4O4 — CID 159660812
2-[3-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]phenyl]acetic acid (PubChem CID 159660812) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[3-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 159660812 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[3-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]phenyl]acetic acid |
| SMILES | CCOc1cc(-c2cccc(CC(=O)O)c2)ccc1-c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H18N4O4/c1-2-29-16-10-14(13-5-3-4-12(8-13)9-17(26)27)6-7-15(16)19-24-20-18(21(28)25-19)22-11-23-20/h3-8,10-11H,2,9H2,1H3,(H,26,27)(H2,22,23,24,25,28) |
| InChIKey | LGLYCPPOMQDHPU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |