C41H52N4O8 — CID 157300636
benzyl (3R)-3-[[(4S)-1-[[(4S,7R)-1,8-diamino-7-(naphthalen-2-ylmethyl)-1,5,8-trioxooctan-4-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate (PubChem CID 157300636) has the molecular formula C41H52N4O8 and a molecular weight of 728.89 g/mol. Its IUPAC name is benzyl (3R)-3-[[(4S)-1-[[(4S,7R)-1,8-diamino-7-(naphthalen-2-ylmethyl)-1,5,8-trioxooctan-4-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate.
| Compound Name | benzyl (3R)-3-[[(4S)-1-[[(4S,7R)-1,8-diamino-7-(naphthalen-2-ylmethyl)-1,5,8-trioxooctan-4-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 157300636 |
| Molecular Formula | C41H52N4O8 |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | benzyl (3R)-3-[[(4S)-1-[[(4S,7R)-1,8-diamino-7-(naphthalen-2-ylmethyl)-1,5,8-trioxooctan-4-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate |
| SMILES | CC[C@H](C)C(NC(=O)[C@@H](CC(=O)OCc1ccccc1)CC(C)C)C(=O)C(=O)N[C@@H](CCC(N)=O)C(=O)C[C@@H](Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C41H52N4O8/c1-5-26(4)37(45-40(51)32(19-25(2)3)23-36(48)53-24-27-11-7-6-8-12-27)38(49)41(52)44-33(17-18-35(42)47)34(46)22-31(39(43)50)21-28-15-16-29-13-9-10-14-30(29)20-28/h6-16,20,25-26,31-33,37H,5,17-19,21-24H2,1-4H3,(H2,42,47)(H2,43,50)(H,44,52)(H,45,51)/t26-,31+,32+,33-,37?/m0/s1 |
| InChIKey | BBVZKUMVJDJIEN-BFFGYUPTSA-N |
| XLogP | 4.09 |
| TPSA | 204.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|