C28H43N5O7 — CID 148934307
benzyl 3-[[1-[[1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate (PubChem CID 148934307) has the molecular formula C28H43N5O7 and a molecular weight of 561.68 g/mol. Its IUPAC name is benzyl 3-[[1-[[1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate.
| Compound Name | benzyl 3-[[1-[[1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 148934307 |
| Molecular Formula | C28H43N5O7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | benzyl 3-[[1-[[1-amino-5-(carbamoylamino)-1-oxopentan-2-yl]amino]-4-methyl-1,2-dioxohexan-3-yl]carbamoyl]-5-methylhexanoate |
| SMILES | CCC(C)C(NC(=O)C(CC(=O)OCc1ccccc1)CC(C)C)C(=O)C(=O)NC(CCCNC(N)=O)C(N)=O |
| InChI | InChI=1S/C28H43N5O7/c1-5-18(4)23(24(35)27(38)32-21(25(29)36)12-9-13-31-28(30)39)33-26(37)20(14-17(2)3)15-22(34)40-16-19-10-7-6-8-11-19/h6-8,10-11,17-18,20-21,23H,5,9,12-16H2,1-4H3,(H2,29,36)(H,32,38)(H,33,37)(H3,30,31,39) |
| InChIKey | PMNZYSYPDJDKHU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 199.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|