C31H43N3O5 — CID 146718476
[4-[3-[3-(carbamoylamino)propyl]-5-methyl-2-oxohexyl]phenyl]methyl N-(4-methyl-3-oxo-1-phenylpentan-2-yl)carbamate (PubChem CID 146718476) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is [4-[3-[3-(carbamoylamino)propyl]-5-methyl-2-oxohexyl]phenyl]methyl N-(4-methyl-3-oxo-1-phenylpentan-2-yl)carbamate.
| Compound Name | [4-[3-[3-(carbamoylamino)propyl]-5-methyl-2-oxohexyl]phenyl]methyl N-(4-methyl-3-oxo-1-phenylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 146718476 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | [4-[3-[3-(carbamoylamino)propyl]-5-methyl-2-oxohexyl]phenyl]methyl N-(4-methyl-3-oxo-1-phenylpentan-2-yl)carbamate |
| SMILES | CC(C)CC(CCCNC(N)=O)C(=O)Cc1ccc(COC(=O)NC(Cc2ccccc2)C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C31H43N3O5/c1-21(2)17-26(11-8-16-33-30(32)37)28(35)19-24-12-14-25(15-13-24)20-39-31(38)34-27(29(36)22(3)4)18-23-9-6-5-7-10-23/h5-7,9-10,12-15,21-22,26-27H,8,11,16-20H2,1-4H3,(H,34,38)(H3,32,33,37) |
| InChIKey | RELBIKNPGPGPDV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|