C36H53N5O6Si — CID 157300956
methyl N-[(E,3S)-8-(dimethylamino)-1-[1-[[4-(3-methylbutan-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl]carbamate (PubChem CID 157300956) has the molecular formula C36H53N5O6Si and a molecular weight of 679.94 g/mol. Its IUPAC name is methyl N-[(E,3S)-8-(dimethylamino)-1-[1-[[4-(3-methylbutan-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl]carbamate.
| Compound Name | methyl N-[(E,3S)-8-(dimethylamino)-1-[1-[[4-(3-methylbutan-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 157300956 |
| Molecular Formula | C36H53N5O6Si |
| Molecular Weight | 679.94 g/mol |
| Exact Mass | 679.38 |
| IUPAC Name | methyl N-[(E,3S)-8-(dimethylamino)-1-[1-[[4-(3-methylbutan-2-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(=O)N(C)C)C(=O)Cc1cccn(Cc2nc3c(C(C)C(C)C)cccc3n2COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C36H53N5O6Si/c1-25(2)26(3)28-15-12-17-30-34(28)38-32(41(30)24-47-20-21-48(7,8)9)23-40-19-13-14-27(35(40)44)22-31(42)29(37-36(45)46-6)16-10-11-18-33(43)39(4)5/h11-15,17-19,25-26,29H,10,16,20-24H2,1-9H3,(H,37,45)/b18-11+/t26?,29-/m0/s1 |
| InChIKey | XXIGPIBHKCAUMF-HCGJDHSZSA-N |
| XLogP | 5.58 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|