C19H25N3O5 — CID 157301004
1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 157301004) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 157301004 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | CC(C)Cn1cc(CC(=O)c2cc([N+](=O)[O-])cn2CC(C)C)cc1C(=O)O |
| InChI | InChI=1S/C19H25N3O5/c1-12(2)8-20-10-14(5-17(20)19(24)25)6-18(23)16-7-15(22(26)27)11-21(16)9-13(3)4/h5,7,10-13H,6,8-9H2,1-4H3,(H,24,25) |
| InChIKey | BBWYSEFFCQVAFU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|