C18H17ClN6O — CID 157301562
2-chloro-5-[[4-methyl-6-(methylamino)pyrimidin-2-yl]amino]-N-pyridin-2-ylbenzamide (PubChem CID 157301562) has the molecular formula C18H17ClN6O and a molecular weight of 368.83 g/mol. Its IUPAC name is 2-chloro-5-[[4-methyl-6-(methylamino)pyrimidin-2-yl]amino]-N-pyridin-2-ylbenzamide.
| Compound Name | 2-chloro-5-[[4-methyl-6-(methylamino)pyrimidin-2-yl]amino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 157301562 |
| Molecular Formula | C18H17ClN6O |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-chloro-5-[[4-methyl-6-(methylamino)pyrimidin-2-yl]amino]-N-pyridin-2-ylbenzamide |
| SMILES | CNc1cc(C)nc(Nc2ccc(Cl)c(C(=O)Nc3ccccn3)c2)n1 |
| InChI | InChI=1S/C18H17ClN6O/c1-11-9-16(20-2)25-18(22-11)23-12-6-7-14(19)13(10-12)17(26)24-15-5-3-4-8-21-15/h3-10H,1-2H3,(H,21,24,26)(H2,20,22,23,25) |
| InChIKey | RGCCPUJFWZHTHB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |