C46H44BBrF6N4O4 — CID 157301791
4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine;[2-(trifluoromethyl)phenyl]boronic acid (PubChem CID 157301791) has the molecular formula C46H44BBrF6N4O4 and a molecular weight of 921.59 g/mol. Its IUPAC name is 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine;[2-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine;[2-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 157301791 |
| Molecular Formula | C46H44BBrF6N4O4 |
| Molecular Weight | 921.59 g/mol |
| Exact Mass | 920.25 |
| IUPAC Name | 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine;[2-(trifluoromethyl)phenyl]boronic acid |
| SMILES | Brc1ccc(CN2CCOC(c3ccccc3)C2)cn1.FC(F)(F)c1ccccc1-c1ccc(CN2CCOC(c3ccccc3)C2)cn1.OB(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N2O.C16H17BrN2O.C7H6BF3O2/c24-23(25,26)20-9-5-4-8-19(20)21-11-10-17(14-27-21)15-28-12-13-29-22(16-28)18-6-2-1-3-7-18;17-16-7-6-13(10-18-16)11-19-8-9-20-15(12-19)14-4-2-1-3-5-14;9-7(10,11)5-3-1-2-4-6(5)8(12)13/h1-11,14,22H,12-13,15-16H2;1-7,10,15H,8-9,11-12H2;1-4,12-13H |
| InChIKey | BBZIDHZEBBJAEH-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.59 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|