C39H38BrF3N4O2 — CID 159566147
4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine (PubChem CID 159566147) has the molecular formula C39H38BrF3N4O2 and a molecular weight of 731.66 g/mol. Its IUPAC name is 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine.
| Compound Name | 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine |
|---|---|
| PubChem CID | 159566147 |
| Molecular Formula | C39H38BrF3N4O2 |
| Molecular Weight | 731.66 g/mol |
| Exact Mass | 730.21 |
| IUPAC Name | 4-[(6-bromo-3-pyridinyl)methyl]-2-phenylmorpholine;2-phenyl-4-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]morpholine |
| SMILES | Brc1ccc(CN2CCOC(c3ccccc3)C2)cn1.FC(F)(F)c1ccccc1-c1ccc(CN2CCOC(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C23H21F3N2O.C16H17BrN2O/c24-23(25,26)20-9-5-4-8-19(20)21-11-10-17(14-27-21)15-28-12-13-29-22(16-28)18-6-2-1-3-7-18;17-16-7-6-13(10-18-16)11-19-8-9-20-15(12-19)14-4-2-1-3-5-14/h1-11,14,22H,12-13,15-16H2;1-7,10,15H,8-9,11-12H2 |
| InChIKey | MHFJKSMFAUWURF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.66 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|