About 4-(3-aminophenoxy)phenol;butane
4-(3-aminophenoxy)phenol;butane (PubChem CID 157302455) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(3-aminophenoxy)phenol;butane.
Molecular Properties
| Compound Name | 4-(3-aminophenoxy)phenol;butane |
| PubChem CID | 157302455 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-(3-aminophenoxy)phenol;butane |
| SMILES | CCCC.Nc1cccc(Oc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C12H11NO2.C4H10/c13-9-2-1-3-12(8-9)15-11-6-4-10(14)5-7-11;1-3-4-2/h1-8,14H,13H2;3-4H2,1-2H3 |
| InChIKey | BCBGDFCUCDKHEI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-aminophenoxy)phenol;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminophenoxy)phenol;butane?
The IUPAC name of 4-(3-aminophenoxy)phenol;butane (CID 157302455) is 4-(3-aminophenoxy)phenol;butane.
What is the SMILES notation for 4-(3-aminophenoxy)phenol;butane?
The canonical SMILES for 4-(3-aminophenoxy)phenol;butane is CCCC.Nc1cccc(Oc2ccc(O)cc2)c1.
What is the InChIKey of 4-(3-aminophenoxy)phenol;butane?
The InChIKey is BCBGDFCUCDKHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.C4H10/c13-9-2-1-3-12(8-9)15-11-6-4-10(14)5-7-11;1-3-4-2/h1-8,14H,13H2;3-4H2,1-2H3.
What are the key properties of 4-(3-aminophenoxy)phenol;butane?
4-(3-aminophenoxy)phenol;butane has a molecular weight of 259.35 g/mol, XLogP of 4.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminophenoxy)phenol;butane is sourced from PubChem (CID 157302455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).