C17H27N5OS — CID 157303457
2,4,5-trimethyl-1,3-oxazole;2,4,5-trimethyl-1,3-thiazole;1,3,5-trimethyl-1,2,4-triazole (PubChem CID 157303457) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-oxazole;2,4,5-trimethyl-1,3-thiazole;1,3,5-trimethyl-1,2,4-triazole.
| Compound Name | 2,4,5-trimethyl-1,3-oxazole;2,4,5-trimethyl-1,3-thiazole;1,3,5-trimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 157303457 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2,4,5-trimethyl-1,3-oxazole;2,4,5-trimethyl-1,3-thiazole;1,3,5-trimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C)c(C)o1.Cc1nc(C)c(C)s1.Cc1nc(C)n(C)n1 |
| InChI | InChI=1S/C6H9NO.C6H9NS.C5H9N3/c2*1-4-5(2)8-6(3)7-4;1-4-6-5(2)8(3)7-4/h3*1-3H3 |
| InChIKey | BCECDSLVCIHVIG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |