C29H29Cl3N6O5 — CID 157304874
3-chlorobenzene-1,2-diamine;5-chloro-3-methyl-1H-quinoxalin-2-one;8-chloro-3-methyl-1H-quinoxalin-2-one;ethyl 2-oxopropanoate (PubChem CID 157304874) has the molecular formula C29H29Cl3N6O5 and a molecular weight of 647.95 g/mol. Its IUPAC name is 3-chlorobenzene-1,2-diamine;5-chloro-3-methyl-1H-quinoxalin-2-one;8-chloro-3-methyl-1H-quinoxalin-2-one;ethyl 2-oxopropanoate.
| Compound Name | 3-chlorobenzene-1,2-diamine;5-chloro-3-methyl-1H-quinoxalin-2-one;8-chloro-3-methyl-1H-quinoxalin-2-one;ethyl 2-oxopropanoate |
|---|---|
| PubChem CID | 157304874 |
| Molecular Formula | C29H29Cl3N6O5 |
| Molecular Weight | 647.95 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 3-chlorobenzene-1,2-diamine;5-chloro-3-methyl-1H-quinoxalin-2-one;8-chloro-3-methyl-1H-quinoxalin-2-one;ethyl 2-oxopropanoate |
| SMILES | CCOC(=O)C(C)=O.Cc1nc2c(Cl)cccc2[nH]c1=O.Cc1nc2cccc(Cl)c2[nH]c1=O.Nc1cccc(Cl)c1N |
| InChI | InChI=1S/2C9H7ClN2O.C6H7ClN2.C5H8O3/c1-5-9(13)12-7-4-2-3-6(10)8(7)11-5;1-5-9(13)12-8-6(10)3-2-4-7(8)11-5;7-4-2-1-3-5(8)6(4)9;1-3-8-5(7)4(2)6/h2*2-4H,1H3,(H,12,13);1-3H,8-9H2;3H2,1-2H3 |
| InChIKey | BCIMLXJYKVGWOL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 186.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.95 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|