C13H12ClNO4 — CID 90455879
ethyl 5-chloro-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 90455879) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is ethyl 5-chloro-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 5-chloro-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 90455879 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | ethyl 5-chloro-4-(hydroxymethyl)-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(CO)c2c(Cl)cccc2[nH]c1=O |
| InChI | InChI=1S/C13H12ClNO4/c1-2-19-13(18)11-7(6-16)10-8(14)4-3-5-9(10)15-12(11)17/h3-5,16H,2,6H2,1H3,(H,15,17) |
| InChIKey | YHLORULHWRXPIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |