C11H9ClN2O3 — CID 59699624
ethyl 4-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylate (PubChem CID 59699624) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is ethyl 4-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 59699624 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | ethyl 4-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c2cnccc2[nH]c1=O |
| InChI | InChI=1S/C11H9ClN2O3/c1-2-17-11(16)8-9(12)6-5-13-4-3-7(6)14-10(8)15/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | HSCVIYSKXQBDHN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |