About (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride
(E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride (PubChem CID 157305166) has the molecular formula C16H11Cl3O5S2
and a molecular weight of 453.75 g/mol. Its IUPAC name is (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride.
Molecular Properties
| Compound Name | (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride |
| PubChem CID | 157305166 |
| Molecular Formula | C16H11Cl3O5S2 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 451.91 |
| IUPAC Name | (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)/C=C/c1ccc(-c2cc3ccccc3o2)cc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C16H11ClO3S.Cl2O2S/c17-21(18,19)10-9-12-5-7-13(8-6-12)16-11-14-3-1-2-4-15(14)20-16;1-5(2,3)4/h1-11H;/b10-9+; |
| InChIKey | BCJMLBDNJZSQAZ-RRABGKBLSA-N |
| XLogP | 5.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride?
The IUPAC name of (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride (CID 157305166) is (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride.
What is the SMILES notation for (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride?
The canonical SMILES for (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride is O=S(=O)(Cl)/C=C/c1ccc(-c2cc3ccccc3o2)cc1.O=S(=O)(Cl)Cl.
What is the InChIKey of (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride?
The InChIKey is BCJMLBDNJZSQAZ-RRABGKBLSA-N. The full InChI is InChI=1S/C16H11ClO3S.Cl2O2S/c17-21(18,19)10-9-12-5-7-13(8-6-12)16-11-14-3-1-2-4-15(14)20-16;1-5(2,3)4/h1-11H;/b10-9+;.
What are the key properties of (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride?
(E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride has a molecular weight of 453.75 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[4-(1-benzofuran-2-yl)phenyl]ethenesulfonyl chloride;sulfuryl dichloride is sourced from PubChem (CID 157305166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).