C22H18N2O5S2 — CID 173483595
2-[4-[2-(2-sulfamoyl-N-sulfinoanilino)ethenyl]phenyl]-1-benzofuran (PubChem CID 173483595) has the molecular formula C22H18N2O5S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[4-[2-(2-sulfamoyl-N-sulfinoanilino)ethenyl]phenyl]-1-benzofuran.
| Compound Name | 2-[4-[2-(2-sulfamoyl-N-sulfinoanilino)ethenyl]phenyl]-1-benzofuran |
|---|---|
| PubChem CID | 173483595 |
| Molecular Formula | C22H18N2O5S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-[4-[2-(2-sulfamoyl-N-sulfinoanilino)ethenyl]phenyl]-1-benzofuran |
| SMILES | NS(=O)(=O)c1ccccc1N(C=Cc1ccc(-c2cc3ccccc3o2)cc1)S(=O)O |
| InChI | InChI=1S/C22H18N2O5S2/c23-31(27,28)22-8-4-2-6-19(22)24(30(25)26)14-13-16-9-11-17(12-10-16)21-15-18-5-1-3-7-20(18)29-21/h1-15H,(H,25,26)(H2,23,27,28) |
| InChIKey | WEIDSZKXJPIDDH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|