C18H17N3O4 — CID 157307504
1-acetyl-5,6-dimethoxy-N-phenylindazole-3-carboxamide (PubChem CID 157307504) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-acetyl-5,6-dimethoxy-N-phenylindazole-3-carboxamide.
| Compound Name | 1-acetyl-5,6-dimethoxy-N-phenylindazole-3-carboxamide |
|---|---|
| PubChem CID | 157307504 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-acetyl-5,6-dimethoxy-N-phenylindazole-3-carboxamide |
| SMILES | COc1cc2c(C(=O)Nc3ccccc3)nn(C(C)=O)c2cc1OC |
| InChI | InChI=1S/C18H17N3O4/c1-11(22)21-14-10-16(25-3)15(24-2)9-13(14)17(20-21)18(23)19-12-7-5-4-6-8-12/h4-10H,1-3H3,(H,19,23) |
| InChIKey | BCQQUCCZXKMDGT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |