C24H29BN2 — CID 157307991
CID 157307991 (PubChem CID 157307991) has the molecular formula C24H29BN2 and a molecular weight of 356.32 g/mol.
| Compound Name | CID 157307991 |
|---|---|
| PubChem CID | 157307991 |
| Molecular Formula | C24H29BN2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | — |
| SMILES | CCCCCC1CCC(c2ccc(C#N)cc2)CC1.[B]C(=C)C#CC#CN |
| InChI | InChI=1S/C18H25N.C6H4BN/c1-2-3-4-5-15-6-10-17(11-7-15)18-12-8-16(14-19)9-13-18;1-6(7)4-2-3-5-8/h8-9,12-13,15,17H,2-7,10-11H2,1H3;1,8H2 |
| InChIKey | SJCDZPQWJMMLPY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|