C22H30O7 — CID 157308063
(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;[(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl] acetate (PubChem CID 157308063) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;[(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl] acetate.
| Compound Name | (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;[(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl] acetate |
|---|---|
| PubChem CID | 157308063 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-ol;[(5R)-3-prop-2-enoxy-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl] acetate |
| SMILES | C=CCOC1OCC2C[C@@H](O)C=C21.C=CCOC1OCC2C[C@@H](OC(C)=O)C=C21 |
| InChI | InChI=1S/C12H16O4.C10H14O3/c1-3-4-14-12-11-6-10(16-8(2)13)5-9(11)7-15-12;1-2-3-12-10-9-5-8(11)4-7(9)6-13-10/h3,6,9-10,12H,1,4-5,7H2,2H3;2,5,7-8,10-11H,1,3-4,6H2/t9?,10-,12?;7?,8-,10?/m11/s1 |
| InChIKey | BCSMMYVQRKABLR-INWBUFNDSA-N |
| XLogP | 2.28 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|