C38H34BBrN4O4 — CID 157308873
3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 157308873) has the molecular formula C38H34BBrN4O4 and a molecular weight of 701.43 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 157308873 |
| Molecular Formula | C38H34BBrN4O4 |
| Molecular Weight | 701.43 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | 3-bromo-5-isocyano-1-(4-methoxyphenyl)indole;5-isocyano-1-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(B1OC(C)(C)C(C)(C)O1)cn2-c1ccc(OC)cc1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23BN2O3.C16H11BrN2O/c1-21(2)22(3,4)28-23(27-21)19-14-25(16-8-10-17(26-6)11-9-16)20-12-7-15(24-5)13-18(19)20;1-18-11-3-8-16-14(9-11)15(17)10-19(16)12-4-6-13(20-2)7-5-12/h7-14H,1-4,6H3;3-10H,2H3 |
| InChIKey | BCUOUFBFXUILGA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.43 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|