C26H29N3O4 — CID 157309132
5-[4-(4-aminobutoxy)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile;1-(4-hydroxyphenyl)propan-2-one (PubChem CID 157309132) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 5-[4-(4-aminobutoxy)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile;1-(4-hydroxyphenyl)propan-2-one.
| Compound Name | 5-[4-(4-aminobutoxy)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile;1-(4-hydroxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 157309132 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 5-[4-(4-aminobutoxy)phenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile;1-(4-hydroxyphenyl)propan-2-one |
| SMILES | CC(=O)Cc1ccc(O)cc1.Cc1[nH]c(=O)c(C#N)cc1-c1ccc(OCCCCN)cc1 |
| InChI | InChI=1S/C17H19N3O2.C9H10O2/c1-12-16(10-14(11-19)17(21)20-12)13-4-6-15(7-5-13)22-9-3-2-8-18;1-7(10)6-8-2-4-9(11)5-3-8/h4-7,10H,2-3,8-9,18H2,1H3,(H,20,21);2-5,11H,6H2,1H3 |
| InChIKey | BCVIKOQYWHQIBJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|