C23H21N3O5 — CID 59706588
[4-[3-[[5-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)-2-pyridinyl]oxy]propoxy]phenyl] acetate (PubChem CID 59706588) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [4-[3-[[5-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)-2-pyridinyl]oxy]propoxy]phenyl] acetate.
| Compound Name | [4-[3-[[5-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)-2-pyridinyl]oxy]propoxy]phenyl] acetate |
|---|---|
| PubChem CID | 59706588 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [4-[3-[[5-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)-2-pyridinyl]oxy]propoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OCCCOc2ccc(-c3cc(C#N)c(=O)[nH]c3C)cn2)cc1 |
| InChI | InChI=1S/C23H21N3O5/c1-15-21(12-18(13-24)23(28)26-15)17-4-9-22(25-14-17)30-11-3-10-29-19-5-7-20(8-6-19)31-16(2)27/h4-9,12,14H,3,10-11H2,1-2H3,(H,26,28) |
| InChIKey | MSGZBGXFPUWMQD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|