C30H35ClN4O5 — CID 70061902
N-[2-[[3-(2-chlorophenoxy)-3-hydroxypropyl]amino]-2-methylpropyl]-4-[4-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]butanamide (PubChem CID 70061902) has the molecular formula C30H35ClN4O5 and a molecular weight of 567.09 g/mol. Its IUPAC name is N-[2-[[3-(2-chlorophenoxy)-3-hydroxypropyl]amino]-2-methylpropyl]-4-[4-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]butanamide.
| Compound Name | N-[2-[[3-(2-chlorophenoxy)-3-hydroxypropyl]amino]-2-methylpropyl]-4-[4-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 70061902 |
| Molecular Formula | C30H35ClN4O5 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | N-[2-[[3-(2-chlorophenoxy)-3-hydroxypropyl]amino]-2-methylpropyl]-4-[4-(5-cyano-2-methyl-6-oxo-1H-pyridin-3-yl)phenoxy]butanamide |
| SMILES | Cc1[nH]c(=O)c(C#N)cc1-c1ccc(OCCCC(=O)NCC(C)(C)NCCC(O)Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H35ClN4O5/c1-20-24(17-22(18-32)29(38)35-20)21-10-12-23(13-11-21)39-16-6-9-27(36)33-19-30(2,3)34-15-14-28(37)40-26-8-5-4-7-25(26)31/h4-5,7-8,10-13,17,28,34,37H,6,9,14-16,19H2,1-3H3,(H,33,36)(H,35,38) |
| InChIKey | HWIPNLDHPVMQMI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|