C18H21ClN2O3 — CID 52804898
4-(2-chlorophenoxy)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]butanamide (PubChem CID 52804898) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 52804898 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]butanamide |
| SMILES | Cc1cc(C)c(CNC(=O)CCCOc2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-12-10-13(2)21-18(23)14(12)11-20-17(22)8-5-9-24-16-7-4-3-6-15(16)19/h3-4,6-7,10H,5,8-9,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZXQHBYHDMQZEBW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|