C15H18Cl2N4OS — CID 157309623
2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one;methane;dihydrochloride (PubChem CID 157309623) has the molecular formula C15H18Cl2N4OS and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one;methane;dihydrochloride.
| Compound Name | 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one;methane;dihydrochloride |
|---|---|
| PubChem CID | 157309623 |
| Molecular Formula | C15H18Cl2N4OS |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one;methane;dihydrochloride |
| SMILES | C.Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccncc1.Cl.Cl |
| InChI | InChI=1S/C14H12N4OS.CH4.2ClH/c1-8-2-3-10-11(13(19)18-14(15)17-10)12(8)20-9-4-6-16-7-5-9;;;/h2-7H,1H3,(H3,15,17,18,19);1H4;2*1H |
| InChIKey | RPRQGHKJIZCCNI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |