C31H26F6N4O2 — CID 157314994
(4R)-4-[3-(3-acetyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-one (PubChem CID 157314994) has the molecular formula C31H26F6N4O2 and a molecular weight of 600.56 g/mol. Its IUPAC name is (4R)-4-[3-(3-acetyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-one.
| Compound Name | (4R)-4-[3-(3-acetyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-one |
|---|---|
| PubChem CID | 157314994 |
| Molecular Formula | C31H26F6N4O2 |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | (4R)-4-[3-(3-acetyl-4-fluorophenyl)-2-pyridinyl]-5-(3,5-difluorophenyl)-1-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-one |
| SMILES | CC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)(F)F)c3c2CNCC3)Cc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/C31H26F6N4O2/c1-17(42)26-13-19(4-5-27(26)34)24-3-2-7-39-29(24)20(9-18-10-21(32)14-22(33)11-18)12-23(43)16-41-28-15-38-8-6-25(28)30(40-41)31(35,36)37/h2-5,7,10-11,13-14,20,38H,6,8-9,12,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | SWRPQORUPHQOKU-HXUWFJFHSA-N |
| XLogP | 6.22 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |