C30H25F6N5O2 — CID 159541925
5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 159541925) has the molecular formula C30H25F6N5O2 and a molecular weight of 601.55 g/mol. Its IUPAC name is 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 159541925 |
| Molecular Formula | C30H25F6N5O2 |
| Molecular Weight | 601.55 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-4-oxo-5-[3-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]pentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)(F)F)c3c2CNCC3)Cc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/C30H25F6N5O2/c31-19-9-16(10-20(32)13-19)8-18(27-22(2-1-6-39-27)17-3-4-25(33)24(12-17)29(37)43)11-21(42)15-41-26-14-38-7-5-23(26)28(40-41)30(34,35)36/h1-4,6,9-10,12-13,18,38H,5,7-8,11,14-15H2,(H2,37,43)/t18-/m1/s1 |
| InChIKey | MEIAQNIKBITGOX-GOSISDBHSA-N |
| XLogP | 5.11 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |