C15H13ClN2O6 — CID 157316589
4-(3-chloro-2-nitrophenyl)-5-ethoxycarbonyl-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 157316589) has the molecular formula C15H13ClN2O6 and a molecular weight of 352.73 g/mol. Its IUPAC name is 4-(3-chloro-2-nitrophenyl)-5-ethoxycarbonyl-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-(3-chloro-2-nitrophenyl)-5-ethoxycarbonyl-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 157316589 |
| Molecular Formula | C15H13ClN2O6 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4-(3-chloro-2-nitrophenyl)-5-ethoxycarbonyl-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)O)c1-c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClN2O6/c1-3-24-15(21)12-11(10(14(19)20)7(2)17-12)8-5-4-6-9(16)13(8)18(22)23/h4-6,17H,3H2,1-2H3,(H,19,20) |
| InChIKey | BDQZDJNREMNDRE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|