C13H11ClN2O4 — CID 154182587
4-(3-chloro-2-nitrophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 154182587) has the molecular formula C13H11ClN2O4 and a molecular weight of 294.69 g/mol. Its IUPAC name is 4-(3-chloro-2-nitrophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-(3-chloro-2-nitrophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 154182587 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-(3-chloro-2-nitrophenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(C)c(-c2cccc(Cl)c2[N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C13H11ClN2O4/c1-6-10(11(13(17)18)7(2)15-6)8-4-3-5-9(14)12(8)16(19)20/h3-5,15H,1-2H3,(H,17,18) |
| InChIKey | XUOAOERHMTZOSN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|