C9H10ClN3O6 — CID 87862178
1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid (PubChem CID 87862178) has the molecular formula C9H10ClN3O6 and a molecular weight of 291.65 g/mol. Its IUPAC name is 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid.
| Compound Name | 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 87862178 |
| Molecular Formula | C9H10ClN3O6 |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid |
| SMILES | CNCC(=O)O.O=[N+]([O-])c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3ClN2O4.C3H7NO2/c7-4-2-1-3-5(8(10)11)6(4)9(12)13;1-4-2-3(5)6/h1-3H;4H,2H2,1H3,(H,5,6) |
| InChIKey | KBNFQUXBXOKOOB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|