1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid

C9H10ClN3O6 — CID 87862178

IUPAC1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid
SMILESCNCC(=O)O.O=[N+]([O-])c1cccc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C6H3ClN2O4.C3H7NO2/c7-4-2-1-3-5(8(10)11)6(4)9(12)13;1-4-2-3(5)6/h1-3H;4H,2H2,1H3,(H,5,6)
InChIKeyKBNFQUXBXOKOOB-UHFFFAOYSA-N
MW291.65 g/mol
LogP1.45
Rot. Bonds4

About 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid

1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid (PubChem CID 87862178) has the molecular formula C9H10ClN3O6 and a molecular weight of 291.65 g/mol. Its IUPAC name is 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid.

Molecular Properties

Compound Name1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid
PubChem CID87862178
Molecular FormulaC9H10ClN3O6
Molecular Weight291.65 g/mol
Exact Mass291.03
IUPAC Name1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid
SMILESCNCC(=O)O.O=[N+]([O-])c1cccc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C6H3ClN2O4.C3H7NO2/c7-4-2-1-3-5(8(10)11)6(4)9(12)13;1-4-2-3(5)6/h1-3H;4H,2H2,1H3,(H,5,6)
InChIKeyKBNFQUXBXOKOOB-UHFFFAOYSA-N
XLogP1.45
TPSA135.61 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.65
LogP ≤ 51.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid?
The IUPAC name of 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid (CID 87862178) is 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid.
What is the SMILES notation for 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid?
The canonical SMILES for 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid is CNCC(=O)O.O=[N+]([O-])c1cccc(Cl)c1[N+](=O)[O-].
What is the InChIKey of 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid?
The InChIKey is KBNFQUXBXOKOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2O4.C3H7NO2/c7-4-2-1-3-5(8(10)11)6(4)9(12)13;1-4-2-3(5)6/h1-3H;4H,2H2,1H3,(H,5,6).
What are the key properties of 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid?
1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid has a molecular weight of 291.65 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-dinitrobenzene;2-(methylamino)acetic acid is sourced from PubChem (CID 87862178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).