C8H4ClNO6 — CID 173206681
4-chloro-2-nitrobenzene-1,3-dicarboxylic acid (PubChem CID 173206681) has the molecular formula C8H4ClNO6 and a molecular weight of 245.57 g/mol. Its IUPAC name is 4-chloro-2-nitrobenzene-1,3-dicarboxylic acid.
| Compound Name | 4-chloro-2-nitrobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 173206681 |
| Molecular Formula | C8H4ClNO6 |
| Molecular Weight | 245.57 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 4-chloro-2-nitrobenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4ClNO6/c9-4-2-1-3(7(11)12)6(10(15)16)5(4)8(13)14/h1-2H,(H,11,12)(H,13,14) |
| InChIKey | KFLNDLOKSXBVAZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|