C32H25F3N10S2 — CID 157318226
2-N-[2-[[2-[[4-amino-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 157318226) has the molecular formula C32H25F3N10S2 and a molecular weight of 670.75 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157318226 |
| Molecular Formula | C32H25F3N10S2 |
| Molecular Weight | 670.75 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(Nc3ccccc3SSc3ccccc3Nc3nc(N)nc(-c4ccc(C(F)(F)F)cc4)n3)n2)cc1 |
| InChI | InChI=1S/C32H25F3N10S2/c1-18-10-12-19(13-11-18)26-40-28(36)44-30(42-26)38-22-6-2-4-8-24(22)46-47-25-9-5-3-7-23(25)39-31-43-27(41-29(37)45-31)20-14-16-21(17-15-20)32(33,34)35/h2-17H,1H3,(H3,36,38,40,42,44)(H3,37,39,41,43,45) |
| InChIKey | VGTIEPGEIVVIGB-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.75 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|