C42H49Cl2N7S2 — CID 157318360
5-chloro-3-(2-isocyanoethylsulfanyl)-1-propan-2-ylindole;5-chloro-3-phenylsulfanyl-1-propan-2-ylindole;2-(4-propan-2-ylpiperazin-1-yl)pyrimidine (PubChem CID 157318360) has the molecular formula C42H49Cl2N7S2 and a molecular weight of 786.94 g/mol. Its IUPAC name is 5-chloro-3-(2-isocyanoethylsulfanyl)-1-propan-2-ylindole;5-chloro-3-phenylsulfanyl-1-propan-2-ylindole;2-(4-propan-2-ylpiperazin-1-yl)pyrimidine.
| Compound Name | 5-chloro-3-(2-isocyanoethylsulfanyl)-1-propan-2-ylindole;5-chloro-3-phenylsulfanyl-1-propan-2-ylindole;2-(4-propan-2-ylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 157318360 |
| Molecular Formula | C42H49Cl2N7S2 |
| Molecular Weight | 786.94 g/mol |
| Exact Mass | 785.29 |
| IUPAC Name | 5-chloro-3-(2-isocyanoethylsulfanyl)-1-propan-2-ylindole;5-chloro-3-phenylsulfanyl-1-propan-2-ylindole;2-(4-propan-2-ylpiperazin-1-yl)pyrimidine |
| SMILES | CC(C)N1CCN(c2ncccn2)CC1.CC(C)n1cc(Sc2ccccc2)c2cc(Cl)ccc21.[C-]#[N+]CCSc1cn(C(C)C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H16ClNS.C14H15ClN2S.C11H18N4/c1-12(2)19-11-17(20-14-6-4-3-5-7-14)15-10-13(18)8-9-16(15)19;1-10(2)17-9-14(18-7-6-16-3)12-8-11(15)4-5-13(12)17;1-10(2)14-6-8-15(9-7-14)11-12-4-3-5-13-11/h3-12H,1-2H3;4-5,8-10H,6-7H2,1-2H3;3-5,10H,6-9H2,1-2H3 |
| InChIKey | BDWIMINAYODTSB-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 46.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.94 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|